C13H10N2O2S — CID 144877699
methyl 4-pyrazol-1-yl-3-(2-sulfanylethynyl)benzoate (PubChem CID 144877699) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is methyl 4-pyrazol-1-yl-3-(2-sulfanylethynyl)benzoate.
| Compound Name | methyl 4-pyrazol-1-yl-3-(2-sulfanylethynyl)benzoate |
|---|---|
| PubChem CID | 144877699 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | methyl 4-pyrazol-1-yl-3-(2-sulfanylethynyl)benzoate |
| SMILES | COC(=O)c1ccc(-n2cccn2)c(C#CS)c1 |
| InChI | InChI=1S/C13H10N2O2S/c1-17-13(16)11-3-4-12(10(9-11)5-8-18)15-7-2-6-14-15/h2-4,6-7,9,18H,1H3 |
| InChIKey | VFMZALKXASLKTH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|