C22H20N4O3S — CID 51592709
N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-4-pyrazol-1-yl-3-(2-pyridin-2-ylethynyl)benzamide (PubChem CID 51592709) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-4-pyrazol-1-yl-3-(2-pyridin-2-ylethynyl)benzamide.
| Compound Name | N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-4-pyrazol-1-yl-3-(2-pyridin-2-ylethynyl)benzamide |
|---|---|
| PubChem CID | 51592709 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-4-pyrazol-1-yl-3-(2-pyridin-2-ylethynyl)benzamide |
| SMILES | C[C@@]1(NC(=O)c2ccc(-n3cccn3)c(C#Cc3ccccn3)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H20N4O3S/c1-22(10-14-30(28,29)16-22)25-21(27)18-7-9-20(26-13-4-12-24-26)17(15-18)6-8-19-5-2-3-11-23-19/h2-5,7,9,11-13,15H,10,14,16H2,1H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | GACRFSNDBKHDJC-JOCHJYFZSA-N |
| XLogP | 1.97 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|