C31H35FN2O — CID 154986653
3-[2-(4-fluorophenyl)ethynyl]-N-[3-(2H-pyrrol-4-yl)propyl]-4-(1,3,3-trimethylcyclohexyl)benzamide (PubChem CID 154986653) has the molecular formula C31H35FN2O and a molecular weight of 470.63 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethynyl]-N-[3-(2H-pyrrol-4-yl)propyl]-4-(1,3,3-trimethylcyclohexyl)benzamide.
| Compound Name | 3-[2-(4-fluorophenyl)ethynyl]-N-[3-(2H-pyrrol-4-yl)propyl]-4-(1,3,3-trimethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 154986653 |
| Molecular Formula | C31H35FN2O |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethynyl]-N-[3-(2H-pyrrol-4-yl)propyl]-4-(1,3,3-trimethylcyclohexyl)benzamide |
| SMILES | CC1(C)CCCC(C)(c2ccc(C(=O)NCCCC3=CCN=C3)cc2C#Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C31H35FN2O/c1-30(2)16-5-17-31(3,22-30)28-14-11-26(29(35)34-18-4-6-24-15-19-33-21-24)20-25(28)10-7-23-8-12-27(32)13-9-23/h8-9,11-15,20-21H,4-6,16-19,22H2,1-3H3,(H,34,35) |
| InChIKey | DKBUCRGSHDWQQD-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|