C27H24N4O2 — CID 161345132
4-[2-[2-pyrazol-1-yl-5-[5-(2H-pyrrol-4-yl)pentanoyl]phenyl]ethynyl]benzamide (PubChem CID 161345132) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-[2-[2-pyrazol-1-yl-5-[5-(2H-pyrrol-4-yl)pentanoyl]phenyl]ethynyl]benzamide.
| Compound Name | 4-[2-[2-pyrazol-1-yl-5-[5-(2H-pyrrol-4-yl)pentanoyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 161345132 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[2-[2-pyrazol-1-yl-5-[5-(2H-pyrrol-4-yl)pentanoyl]phenyl]ethynyl]benzamide |
| SMILES | NC(=O)c1ccc(C#Cc2cc(C(=O)CCCCC3=CCN=C3)ccc2-n2cccn2)cc1 |
| InChI | InChI=1S/C27H24N4O2/c28-27(33)22-9-6-20(7-10-22)8-11-23-18-24(12-13-25(23)31-17-3-15-30-31)26(32)5-2-1-4-21-14-16-29-19-21/h3,6-7,9-10,12-15,17-19H,1-2,4-5,16H2,(H2,28,33) |
| InChIKey | YGVVFWQLGAGGJY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|