C64H46N2 — CID 154987174
4-(3-cyclohexa-1,3-dien-1-ylphenyl)-6-(2-phenylphenyl)-2-[4-(2,3,4,5-tetraphenylphenyl)phenyl]pyrimidine (PubChem CID 154987174) has the molecular formula C64H46N2 and a molecular weight of 843.09 g/mol. Its IUPAC name is 4-(3-cyclohexa-1,3-dien-1-ylphenyl)-6-(2-phenylphenyl)-2-[4-(2,3,4,5-tetraphenylphenyl)phenyl]pyrimidine.
| Compound Name | 4-(3-cyclohexa-1,3-dien-1-ylphenyl)-6-(2-phenylphenyl)-2-[4-(2,3,4,5-tetraphenylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 154987174 |
| Molecular Formula | C64H46N2 |
| Molecular Weight | 843.09 g/mol |
| Exact Mass | 842.37 |
| IUPAC Name | 4-(3-cyclohexa-1,3-dien-1-ylphenyl)-6-(2-phenylphenyl)-2-[4-(2,3,4,5-tetraphenylphenyl)phenyl]pyrimidine |
| SMILES | C1=CCCC(c2cccc(-c3cc(-c4ccccc4-c4ccccc4)nc(-c4ccc(-c5cc(-c6ccccc6)c(-c6ccccc6)c(-c6ccccc6)c5-c5ccccc5)cc4)n3)c2)=C1 |
| InChI | InChI=1S/C64H46N2/c1-7-22-45(23-8-1)53-34-21-35-54(42-53)59-44-60(56-37-20-19-36-55(56)46-24-9-2-10-25-46)66-64(65-59)52-40-38-48(39-41-52)58-43-57(47-26-11-3-12-27-47)61(49-28-13-4-14-29-49)63(51-32-17-6-18-33-51)62(58)50-30-15-5-16-31-50/h1-7,9-22,24-44H,8,23H2 |
| InChIKey | POIMCOUJUJJQGJ-UHFFFAOYSA-N |
| XLogP | 17.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.09 |
| LogP ≤ 5 | 17.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |