C33H31NO3 — CID 154988230
(4-benzoylphenyl) 4-carbazol-9-yl-2,2,3-trimethylpentanoate (PubChem CID 154988230) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is (4-benzoylphenyl) 4-carbazol-9-yl-2,2,3-trimethylpentanoate.
| Compound Name | (4-benzoylphenyl) 4-carbazol-9-yl-2,2,3-trimethylpentanoate |
|---|---|
| PubChem CID | 154988230 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (4-benzoylphenyl) 4-carbazol-9-yl-2,2,3-trimethylpentanoate |
| SMILES | CC(C(C)C(C)(C)C(=O)Oc1ccc(C(=O)c2ccccc2)cc1)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C33H31NO3/c1-22(23(2)34-29-16-10-8-14-27(29)28-15-9-11-17-30(28)34)33(3,4)32(36)37-26-20-18-25(19-21-26)31(35)24-12-6-5-7-13-24/h5-23H,1-4H3 |
| InChIKey | CHJOXDDUPOUFTF-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|