C28H42O2S5 — CID 154988756
2-[2-[3-[4-[[3-[3-(2-propylsulfanylethylsulfanyl)propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol (PubChem CID 154988756) has the molecular formula C28H42O2S5 and a molecular weight of 570.98 g/mol. Its IUPAC name is 2-[2-[3-[4-[[3-[3-(2-propylsulfanylethylsulfanyl)propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol.
| Compound Name | 2-[2-[3-[4-[[3-[3-(2-propylsulfanylethylsulfanyl)propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 154988756 |
| Molecular Formula | C28H42O2S5 |
| Molecular Weight | 570.98 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 2-[2-[3-[4-[[3-[3-(2-propylsulfanylethylsulfanyl)propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol |
| SMILES | CCCSCCSCCCOc1cccc(Cc2ccc(OCCCSCCSCCS)cc2)c1 |
| InChI | InChI=1S/C28H42O2S5/c1-2-15-32-19-20-33-17-5-13-30-28-7-3-6-26(24-28)23-25-8-10-27(11-9-25)29-12-4-16-34-21-22-35-18-14-31/h3,6-11,24,31H,2,4-5,12-23H2,1H3 |
| InChIKey | ZODRKVPIGFSLLC-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.98 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|