C39H48O2S6 — CID 154988794
2-[2-[3-[4-[diphenyl-[4-[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol (PubChem CID 154988794) has the molecular formula C39H48O2S6 and a molecular weight of 741.21 g/mol. Its IUPAC name is 2-[2-[3-[4-[diphenyl-[4-[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol.
| Compound Name | 2-[2-[3-[4-[diphenyl-[4-[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 154988794 |
| Molecular Formula | C39H48O2S6 |
| Molecular Weight | 741.21 g/mol |
| Exact Mass | 740.20 |
| IUPAC Name | 2-[2-[3-[4-[diphenyl-[4-[3-[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]propoxy]phenyl]methyl]phenoxy]propylsulfanyl]ethylsulfanyl]ethanethiol |
| SMILES | SCCSCCSCCCOc1ccc(C(c2ccccc2)(c2ccccc2)c2ccc(OCCCSCCSCCS)cc2)cc1 |
| InChI | InChI=1S/C39H48O2S6/c42-23-27-46-31-29-44-25-7-21-40-37-17-13-35(14-18-37)39(33-9-3-1-4-10-33,34-11-5-2-6-12-34)36-15-19-38(20-16-36)41-22-8-26-45-30-32-47-28-24-43/h1-6,9-20,42-43H,7-8,21-32H2 |
| InChIKey | MVIKLZWMLVOZHB-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.21 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|