C17H28OSi — CID 15498888
(E)-4-[benzyl(dimethyl)silyl]oct-3-en-1-ol (PubChem CID 15498888) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is (E)-4-[benzyl(dimethyl)silyl]oct-3-en-1-ol.
| Compound Name | (E)-4-[benzyl(dimethyl)silyl]oct-3-en-1-ol |
|---|---|
| PubChem CID | 15498888 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (E)-4-[benzyl(dimethyl)silyl]oct-3-en-1-ol |
| SMILES | CCCC/C(=C\CCO)[Si](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H28OSi/c1-4-5-12-17(13-9-14-18)19(2,3)15-16-10-7-6-8-11-16/h6-8,10-11,13,18H,4-5,9,12,14-15H2,1-3H3/b17-13+ |
| InChIKey | SIMMRNCMEFHZHH-GHRIWEEISA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|