C25H22FN3O3 — CID 154989146
2-[(Z)-2-[[5-[2-(azetidin-1-yl)-2-oxoethyl]indol-1-yl]methyl]-3-fluoroprop-2-enyl]isoindole-1,3-dione (PubChem CID 154989146) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-[(Z)-2-[[5-[2-(azetidin-1-yl)-2-oxoethyl]indol-1-yl]methyl]-3-fluoroprop-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-2-[[5-[2-(azetidin-1-yl)-2-oxoethyl]indol-1-yl]methyl]-3-fluoroprop-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154989146 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[(Z)-2-[[5-[2-(azetidin-1-yl)-2-oxoethyl]indol-1-yl]methyl]-3-fluoroprop-2-enyl]isoindole-1,3-dione |
| SMILES | O=C(Cc1ccc2c(ccn2C/C(=C/F)CN2C(=O)c3ccccc3C2=O)c1)N1CCC1 |
| InChI | InChI=1S/C25H22FN3O3/c26-14-18(16-29-24(31)20-4-1-2-5-21(20)25(29)32)15-28-11-8-19-12-17(6-7-22(19)28)13-23(30)27-9-3-10-27/h1-2,4-8,11-12,14H,3,9-10,13,15-16H2/b18-14- |
| InChIKey | BBGHWXARPCIQQR-JXAWBTAJSA-N |
| XLogP | 3.57 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|