About 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine
4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine (PubChem CID 154990626) has the molecular formula C9H7ClFN3
and a molecular weight of 211.63 g/mol. Its IUPAC name is 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine.
Analyze 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine?
The IUPAC name of 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine (CID 154990626) is 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine?
The canonical SMILES for 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine is Cc1nc(Cl)c2cnc(C)c(F)c2n1.
What is the InChIKey of 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine?
The InChIKey is BEFYUWAHIYCJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClFN3/c1-4-7(11)8-6(3-12-4)9(10)14-5(2)13-8/h3H,1-2H3.
What are the key properties of 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine?
4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine has a molecular weight of 211.63 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-8-fluoro-2,7-dimethylpyrido[4,3-d]pyrimidine is sourced from PubChem (CID 154990626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).