C23H24F2N6O2 — CID 154991673
1-(2-ethoxyethyl)-5-fluoro-N-[6-[4-(1-fluoropropan-2-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]indole-6-carboxamide (PubChem CID 154991673) has the molecular formula C23H24F2N6O2 and a molecular weight of 454.48 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-fluoro-N-[6-[4-(1-fluoropropan-2-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]indole-6-carboxamide.
| Compound Name | 1-(2-ethoxyethyl)-5-fluoro-N-[6-[4-(1-fluoropropan-2-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 154991673 |
| Molecular Formula | C23H24F2N6O2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-fluoro-N-[6-[4-(1-fluoropropan-2-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]indole-6-carboxamide |
| SMILES | CCOCCn1ccc2cc(F)c(C(=O)Nc3cccc(-c4nncn4C(C)CF)n3)cc21 |
| InChI | InChI=1S/C23H24F2N6O2/c1-3-33-10-9-30-8-7-16-11-18(25)17(12-20(16)30)23(32)28-21-6-4-5-19(27-21)22-29-26-14-31(22)15(2)13-24/h4-8,11-12,14-15H,3,9-10,13H2,1-2H3,(H,27,28,32) |
| InChIKey | YERFOQJNEXJGGP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|