C23H25FN6O2 — CID 154991704
1-(2-ethoxyethyl)-5-fluoro-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]indole-6-carboxamide (PubChem CID 154991704) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-fluoro-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]indole-6-carboxamide.
| Compound Name | 1-(2-ethoxyethyl)-5-fluoro-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 154991704 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-fluoro-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]indole-6-carboxamide |
| SMILES | CCOCCn1ccc2cc(F)c(C(=O)Nc3cccc(-c4nncn4C(C)C)n3)cc21 |
| InChI | InChI=1S/C23H25FN6O2/c1-4-32-11-10-29-9-8-16-12-18(24)17(13-20(16)29)23(31)27-21-7-5-6-19(26-21)22-28-25-14-30(22)15(2)3/h5-9,12-15H,4,10-11H2,1-3H3,(H,26,27,31) |
| InChIKey | AQPXCEYAWDOWFR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|