C20H21FN6O3 — CID 154994598
7-[7-(4-fluoropiperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-2-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 154994598) has the molecular formula C20H21FN6O3 and a molecular weight of 412.43 g/mol. Its IUPAC name is 7-[7-(4-fluoropiperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-2-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 7-[7-(4-fluoropiperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-2-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 154994598 |
| Molecular Formula | C20H21FN6O3 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 7-[7-(4-fluoropiperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-2-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | Cn1nc2cc(N3CCOc4cc(C(=O)N5CCC(F)CC5)cnc43)ccn2c1=O |
| InChI | InChI=1S/C20H21FN6O3/c1-24-20(29)27-7-4-15(11-17(27)23-24)26-8-9-30-16-10-13(12-22-18(16)26)19(28)25-5-2-14(21)3-6-25/h4,7,10-12,14H,2-3,5-6,8-9H2,1H3 |
| InChIKey | KIVUMASFONIDCW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |