C16H18N4O4 — CID 154998706
methyl 1-(oxan-2-yl)-4-(pyridine-3-carbonylamino)pyrazole-3-carboxylate (PubChem CID 154998706) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl 1-(oxan-2-yl)-4-(pyridine-3-carbonylamino)pyrazole-3-carboxylate.
| Compound Name | methyl 1-(oxan-2-yl)-4-(pyridine-3-carbonylamino)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 154998706 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl 1-(oxan-2-yl)-4-(pyridine-3-carbonylamino)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C2CCCCO2)cc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H18N4O4/c1-23-16(22)14-12(18-15(21)11-5-4-7-17-9-11)10-20(19-14)13-6-2-3-8-24-13/h4-5,7,9-10,13H,2-3,6,8H2,1H3,(H,18,21) |
| InChIKey | HUIMGIJVKOUFIU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |