C21H21N5O2 — CID 154998844
N-[4-[(dimethylamino)methyl]phenyl]-4-[2-(5-methoxy-3-pyridinyl)ethynyl]-1H-pyrazole-5-carboxamide (PubChem CID 154998844) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[4-[(dimethylamino)methyl]phenyl]-4-[2-(5-methoxy-3-pyridinyl)ethynyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-[(dimethylamino)methyl]phenyl]-4-[2-(5-methoxy-3-pyridinyl)ethynyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 154998844 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[4-[(dimethylamino)methyl]phenyl]-4-[2-(5-methoxy-3-pyridinyl)ethynyl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1cncc(C#Cc2cn[nH]c2C(=O)Nc2ccc(CN(C)C)cc2)c1 |
| InChI | InChI=1S/C21H21N5O2/c1-26(2)14-15-5-8-18(9-6-15)24-21(27)20-17(12-23-25-20)7-4-16-10-19(28-3)13-22-11-16/h5-6,8-13H,14H2,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | VEJWNTLACADPHI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|