C15H24N4O3 — CID 154998873
4-[(4-methylpiperazin-1-yl)methyl]-1-(oxan-2-yl)pyrazole-3-carboxylic acid (PubChem CID 154998873) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)methyl]-1-(oxan-2-yl)pyrazole-3-carboxylic acid.
| Compound Name | 4-[(4-methylpiperazin-1-yl)methyl]-1-(oxan-2-yl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 154998873 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-1-(oxan-2-yl)pyrazole-3-carboxylic acid |
| SMILES | CN1CCN(Cc2cn(C3CCCCO3)nc2C(=O)O)CC1 |
| InChI | InChI=1S/C15H24N4O3/c1-17-5-7-18(8-6-17)10-12-11-19(16-14(12)15(20)21)13-4-2-3-9-22-13/h11,13H,2-10H2,1H3,(H,20,21) |
| InChIKey | TXNDOTUAZAPVLJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |