C23H19N3O2 — CID 154999220
4-[(8-hydroxy-2-methylquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzaldehyde (PubChem CID 154999220) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[(8-hydroxy-2-methylquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzaldehyde.
| Compound Name | 4-[(8-hydroxy-2-methylquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzaldehyde |
|---|---|
| PubChem CID | 154999220 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-[(8-hydroxy-2-methylquinolin-7-yl)-(pyridin-2-ylamino)methyl]benzaldehyde |
| SMILES | Cc1ccc2ccc(C(Nc3ccccn3)c3ccc(C=O)cc3)c(O)c2n1 |
| InChI | InChI=1S/C23H19N3O2/c1-15-5-8-18-11-12-19(23(28)22(18)25-15)21(26-20-4-2-3-13-24-20)17-9-6-16(14-27)7-10-17/h2-14,21,28H,1H3,(H,24,26) |
| InChIKey | SDOLDDWQPVWXDS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|