C20H24F2N3O3P — CID 154999702
2-[4-[5-[[3-[difluoro(phosphanyl)methyl]phenoxy]methyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde (PubChem CID 154999702) has the molecular formula C20H24F2N3O3P and a molecular weight of 423.40 g/mol. Its IUPAC name is 2-[4-[5-[[3-[difluoro(phosphanyl)methyl]phenoxy]methyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde.
| Compound Name | 2-[4-[5-[[3-[difluoro(phosphanyl)methyl]phenoxy]methyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 154999702 |
| Molecular Formula | C20H24F2N3O3P |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[4-[5-[[3-[difluoro(phosphanyl)methyl]phenoxy]methyl]-4-methyl-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde |
| SMILES | Cn1c(COc2cccc(C(F)(F)P)c2)nnc1C1CCC(C2(C=O)CO2)CC1 |
| InChI | InChI=1S/C20H24F2N3O3P/c1-25-17(10-27-16-4-2-3-15(9-16)20(21,22)29)23-24-18(25)13-5-7-14(8-6-13)19(11-26)12-28-19/h2-4,9,11,13-14H,5-8,10,12,29H2,1H3 |
| InChIKey | HYJVYSGVKSQGOE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|