C27H37BN7O3 — CID 155633270
CID 155633270 (PubChem CID 155633270) has the molecular formula C27H37BN7O3 and a molecular weight of 518.45 g/mol.
| Compound Name | CID 155633270 |
|---|---|
| PubChem CID | 155633270 |
| Molecular Formula | C27H37BN7O3 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(OCc2nnc(C3CCC(n4cc(C5(O)CCN([B]C=O)CC5)nn4)CC3)n2C)c1 |
| InChI | InChI=1S/C27H37BN7O3/c1-19(2)21-5-4-6-23(15-21)38-17-25-30-31-26(33(25)3)20-7-9-22(10-8-20)35-16-24(29-32-35)27(37)11-13-34(14-12-27)28-18-36/h4-6,15-16,18-20,22,37H,7-14,17H2,1-3H3 |
| InChIKey | WHTWYIBJFAQWHS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|