C25H28N2O3 — CID 155000784
(E)-5-hydroxy-1-(1-methylpyrrol-2-yl)-7-[3-(2-pyridin-2-ylethoxy)phenyl]hept-1-en-3-one (PubChem CID 155000784) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (E)-5-hydroxy-1-(1-methylpyrrol-2-yl)-7-[3-(2-pyridin-2-ylethoxy)phenyl]hept-1-en-3-one.
| Compound Name | (E)-5-hydroxy-1-(1-methylpyrrol-2-yl)-7-[3-(2-pyridin-2-ylethoxy)phenyl]hept-1-en-3-one |
|---|---|
| PubChem CID | 155000784 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (E)-5-hydroxy-1-(1-methylpyrrol-2-yl)-7-[3-(2-pyridin-2-ylethoxy)phenyl]hept-1-en-3-one |
| SMILES | Cn1cccc1/C=C/C(=O)CC(O)CCc1cccc(OCCc2ccccn2)c1 |
| InChI | InChI=1S/C25H28N2O3/c1-27-16-5-8-22(27)11-13-24(29)19-23(28)12-10-20-6-4-9-25(18-20)30-17-14-21-7-2-3-15-26-21/h2-9,11,13,15-16,18,23,28H,10,12,14,17,19H2,1H3/b13-11+ |
| InChIKey | FLYSFZDNNVSSLW-ACCUITESSA-N |
| XLogP | 4.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|