C24H27N3O5 — CID 155007571
(E)-3-[4-[(Z)-3-[benzyl(methyl)carbamoyl]oxy-2-(dimethylamino)-1-(methylideneamino)prop-1-enyl]phenoxy]prop-2-enoic acid (PubChem CID 155007571) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-3-[benzyl(methyl)carbamoyl]oxy-2-(dimethylamino)-1-(methylideneamino)prop-1-enyl]phenoxy]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(Z)-3-[benzyl(methyl)carbamoyl]oxy-2-(dimethylamino)-1-(methylideneamino)prop-1-enyl]phenoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 155007571 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (E)-3-[4-[(Z)-3-[benzyl(methyl)carbamoyl]oxy-2-(dimethylamino)-1-(methylideneamino)prop-1-enyl]phenoxy]prop-2-enoic acid |
| SMILES | C=N/C(=C(/COC(=O)N(C)Cc1ccccc1)N(C)C)c1ccc(O/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C24H27N3O5/c1-25-23(19-10-12-20(13-11-19)31-15-14-22(28)29)21(26(2)3)17-32-24(30)27(4)16-18-8-6-5-7-9-18/h5-15H,1,16-17H2,2-4H3,(H,28,29)/b15-14+,23-21- |
| InChIKey | KCIBLOWXDBCSEO-GONAIXDFSA-N |
| XLogP | 3.86 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|