C13H17N3S2 — CID 155014307
1-[[(1S)-2-(4-aminophenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]ethanethiol (PubChem CID 155014307) has the molecular formula C13H17N3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 1-[[(1S)-2-(4-aminophenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]ethanethiol.
| Compound Name | 1-[[(1S)-2-(4-aminophenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]ethanethiol |
|---|---|
| PubChem CID | 155014307 |
| Molecular Formula | C13H17N3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1-[[(1S)-2-(4-aminophenyl)-1-(1,3-thiazol-2-yl)ethyl]amino]ethanethiol |
| SMILES | CC(S)N[C@@H](Cc1ccc(N)cc1)c1nccs1 |
| InChI | InChI=1S/C13H17N3S2/c1-9(17)16-12(13-15-6-7-18-13)8-10-2-4-11(14)5-3-10/h2-7,9,12,16-17H,8,14H2,1H3/t9?,12-/m0/s1 |
| InChIKey | NJZDZUOOCHCFGV-ACGXKRRESA-N |
| XLogP | 2.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|