C24H29F3O6 — CID 155014792
2-[5-octoxy-2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyethyl 2-methylprop-2-enoate (PubChem CID 155014792) has the molecular formula C24H29F3O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2-[5-octoxy-2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-octoxy-2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155014792 |
| Molecular Formula | C24H29F3O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[5-octoxy-2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(OCCCCCCCC)c2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H29F3O6/c1-4-5-6-7-8-9-10-31-19-13-17(30-11-12-32-23(29)16(2)3)14-20-22(19)18(24(25,26)27)15-21(28)33-20/h13-15H,2,4-12H2,1,3H3 |
| InChIKey | PXVTUTWHFZDPFC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|