C23H22N4O4S — CID 155016116
2-(5,11-dihydro-[1]benzothiepino[3,4-c]pyridin-11-yl)-11,12-dihydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-9-one (PubChem CID 155016116) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-(5,11-dihydro-[1]benzothiepino[3,4-c]pyridin-11-yl)-11,12-dihydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-9-one.
| Compound Name | 2-(5,11-dihydro-[1]benzothiepino[3,4-c]pyridin-11-yl)-11,12-dihydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-9-one |
|---|---|
| PubChem CID | 155016116 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-(5,11-dihydro-[1]benzothiepino[3,4-c]pyridin-11-yl)-11,12-dihydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-9-one |
| SMILES | O=C1C2=C(O)C(O)C=CN2N(C2c3ccncc3CSc3ccccc32)C2COCCN12 |
| InChI | InChI=1S/C23H22N4O4S/c28-17-6-8-26-21(22(17)29)23(30)25-9-10-31-12-19(25)27(26)20-15-5-7-24-11-14(15)13-32-18-4-2-1-3-16(18)20/h1-8,11,17,19-20,28-29H,9-10,12-13H2 |
| InChIKey | WHPDRIMILXJRAQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |