C27H22ClN5O2S2 — CID 155017090
2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(3-oxo-1H-2-benzothiophen-5-yl)acetamide (PubChem CID 155017090) has the molecular formula C27H22ClN5O2S2 and a molecular weight of 548.09 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(3-oxo-1H-2-benzothiophen-5-yl)acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(3-oxo-1H-2-benzothiophen-5-yl)acetamide |
|---|---|
| PubChem CID | 155017090 |
| Molecular Formula | C27H22ClN5O2S2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(3-oxo-1H-2-benzothiophen-5-yl)acetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)Nc1ccc3c(c1)C(=O)SC3)c1nnc(C)n1-2 |
| InChI | InChI=1S/C27H22ClN5O2S2/c1-13-14(2)37-26-23(13)24(16-4-7-18(28)8-5-16)30-21(25-32-31-15(3)33(25)26)11-22(34)29-19-9-6-17-12-36-27(35)20(17)10-19/h4-10,21H,11-12H2,1-3H3,(H,29,34)/t21-/m0/s1 |
| InChIKey | BPRMCNNRHZLJJE-NRFANRHFSA-N |
| XLogP | 6.22 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|