C27H23ClN6O3S — CID 164786020
2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(1E)-1-hydroxyimino-3H-2-benzofuran-5-yl]acetamide (PubChem CID 164786020) has the molecular formula C27H23ClN6O3S and a molecular weight of 547.04 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(1E)-1-hydroxyimino-3H-2-benzofuran-5-yl]acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(1E)-1-hydroxyimino-3H-2-benzofuran-5-yl]acetamide |
|---|---|
| PubChem CID | 164786020 |
| Molecular Formula | C27H23ClN6O3S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[(1E)-1-hydroxyimino-3H-2-benzofuran-5-yl]acetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)Nc1ccc3c(c1)CO/C3=N/O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C27H23ClN6O3S/c1-13-14(2)38-27-23(13)24(16-4-6-18(28)7-5-16)30-21(25-32-31-15(3)34(25)27)11-22(35)29-19-8-9-20-17(10-19)12-37-26(20)33-36/h4-10,21,36H,11-12H2,1-3H3,(H,29,35)/b33-26+/t21-/m0/s1 |
| InChIKey | RMBPPRWDWWNWGV-BPOZMFCZSA-N |
| XLogP | 5.49 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|