C29H23Cl2NO3S — CID 155017251
1-(2-chlorophenyl)ethyl N-[5-chloro-2-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]thiophen-3-yl]carbamate (PubChem CID 155017251) has the molecular formula C29H23Cl2NO3S and a molecular weight of 536.48 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl N-[5-chloro-2-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]thiophen-3-yl]carbamate.
| Compound Name | 1-(2-chlorophenyl)ethyl N-[5-chloro-2-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 155017251 |
| Molecular Formula | C29H23Cl2NO3S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl N-[5-chloro-2-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]thiophen-3-yl]carbamate |
| SMILES | CC(OC(=O)Nc1cc(Cl)sc1-c1ccc(-c2ccc(C3(C=O)CC3)cc2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C29H23Cl2NO3S/c1-18(23-4-2-3-5-24(23)30)35-28(34)32-25-16-26(31)36-27(25)21-8-6-19(7-9-21)20-10-12-22(13-11-20)29(17-33)14-15-29/h2-13,16-18H,14-15H2,1H3,(H,32,34) |
| InChIKey | KKOGARAJBHCJER-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|