C29H24ClNO5 — CID 89447842
[1-[4-[4-[2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]furan-3-yl]phenyl]phenyl]cyclopropyl] formate (PubChem CID 89447842) has the molecular formula C29H24ClNO5 and a molecular weight of 501.97 g/mol. Its IUPAC name is [1-[4-[4-[2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]furan-3-yl]phenyl]phenyl]cyclopropyl] formate.
| Compound Name | [1-[4-[4-[2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]furan-3-yl]phenyl]phenyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 89447842 |
| Molecular Formula | C29H24ClNO5 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | [1-[4-[4-[2-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]furan-3-yl]phenyl]phenyl]cyclopropyl] formate |
| SMILES | C[C@@H](OC(=O)Nc1occc1-c1ccc(-c2ccc(C3(OC=O)CC3)cc2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C29H24ClNO5/c1-19(24-4-2-3-5-26(24)30)36-28(33)31-27-25(14-17-34-27)22-8-6-20(7-9-22)21-10-12-23(13-11-21)29(15-16-29)35-18-32/h2-14,17-19H,15-16H2,1H3,(H,31,33)/t19-/m1/s1 |
| InChIKey | XTPXKQVVQCKUNX-LJQANCHMSA-N |
| XLogP | 7.74 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|