C30H27NO4 — CID 89447850
[1-[4-[4-[2-[[(1R)-1-phenylethoxy]carbonylamino]cyclopenta-1,4-dien-1-yl]phenyl]phenyl]cyclopropyl] formate (PubChem CID 89447850) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is [1-[4-[4-[2-[[(1R)-1-phenylethoxy]carbonylamino]cyclopenta-1,4-dien-1-yl]phenyl]phenyl]cyclopropyl] formate.
| Compound Name | [1-[4-[4-[2-[[(1R)-1-phenylethoxy]carbonylamino]cyclopenta-1,4-dien-1-yl]phenyl]phenyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 89447850 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [1-[4-[4-[2-[[(1R)-1-phenylethoxy]carbonylamino]cyclopenta-1,4-dien-1-yl]phenyl]phenyl]cyclopropyl] formate |
| SMILES | C[C@@H](OC(=O)NC1=C(c2ccc(-c3ccc(C4(OC=O)CC4)cc3)cc2)C=CC1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO4/c1-21(22-6-3-2-4-7-22)35-29(33)31-28-9-5-8-27(28)25-12-10-23(11-13-25)24-14-16-26(17-15-24)30(18-19-30)34-20-32/h2-8,10-17,20-21H,9,18-19H2,1H3,(H,31,33)/t21-/m1/s1 |
| InChIKey | MHPJNJOOBVQDDS-OAQYLSRUSA-N |
| XLogP | 6.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|