C29H30ClNO3 — CID 155017397
(1Z)-1-[(E)-5-chloro-3-phenylmethoxypent-3-en-2-ylidene]-5-methoxy-6-phenylmethoxy-3,4-dihydro-2H-isoquinoline (PubChem CID 155017397) has the molecular formula C29H30ClNO3 and a molecular weight of 476.02 g/mol. Its IUPAC name is (1Z)-1-[(E)-5-chloro-3-phenylmethoxypent-3-en-2-ylidene]-5-methoxy-6-phenylmethoxy-3,4-dihydro-2H-isoquinoline.
| Compound Name | (1Z)-1-[(E)-5-chloro-3-phenylmethoxypent-3-en-2-ylidene]-5-methoxy-6-phenylmethoxy-3,4-dihydro-2H-isoquinoline |
|---|---|
| PubChem CID | 155017397 |
| Molecular Formula | C29H30ClNO3 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (1Z)-1-[(E)-5-chloro-3-phenylmethoxypent-3-en-2-ylidene]-5-methoxy-6-phenylmethoxy-3,4-dihydro-2H-isoquinoline |
| SMILES | COc1c(OCc2ccccc2)ccc2c1CCN/C2=C(C)\C(=C/CCl)OCc1ccccc1 |
| InChI | InChI=1S/C29H30ClNO3/c1-21(26(15-17-30)33-19-22-9-5-3-6-10-22)28-24-13-14-27(29(32-2)25(24)16-18-31-28)34-20-23-11-7-4-8-12-23/h3-15,31H,16-20H2,1-2H3/b26-15+,28-21- |
| InChIKey | BGLUBWOKSMWTNH-BLRGYFEDSA-N |
| XLogP | 6.49 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|