C16H20ClNO3 — CID 69114272
(2,6-dimethoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride (PubChem CID 69114272) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is (2,6-dimethoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (2,6-dimethoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 69114272 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2,6-dimethoxy-3-phenylmethoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1ccc(OCc2ccccc2)c(OC)c1CN.Cl |
| InChI | InChI=1S/C16H19NO3.ClH/c1-18-14-8-9-15(16(19-2)13(14)10-17)20-11-12-6-4-3-5-7-12;/h3-9H,10-11,17H2,1-2H3;1H |
| InChIKey | PPBDPPAPRNTHMW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |