C22H21ClO — CID 155017580
(1E,4Z,6E)-5-chloro-1-(3,4-dimethylphenyl)-7-(3-methylphenyl)hepta-1,4,6-trien-3-one (PubChem CID 155017580) has the molecular formula C22H21ClO and a molecular weight of 336.86 g/mol. Its IUPAC name is (1E,4Z,6E)-5-chloro-1-(3,4-dimethylphenyl)-7-(3-methylphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-chloro-1-(3,4-dimethylphenyl)-7-(3-methylphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 155017580 |
| Molecular Formula | C22H21ClO |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (1E,4Z,6E)-5-chloro-1-(3,4-dimethylphenyl)-7-(3-methylphenyl)hepta-1,4,6-trien-3-one |
| SMILES | Cc1cccc(/C=C/C(Cl)=C/C(=O)/C=C/c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C22H21ClO/c1-16-5-4-6-19(13-16)9-11-21(23)15-22(24)12-10-20-8-7-17(2)18(3)14-20/h4-15H,1-3H3/b11-9+,12-10+,21-15- |
| InChIKey | TVPRREAXLHFGCD-QZYCINNWSA-N |
| XLogP | 6.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|