C17H22FNO3 — CID 155019917
(3R)-1-cyclopentyl-3-fluoro-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 155019917) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is (3R)-1-cyclopentyl-3-fluoro-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-cyclopentyl-3-fluoro-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155019917 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3R)-1-cyclopentyl-3-fluoro-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(C2CN(C3CCCC3)C[C@@]2(F)C(=O)O)cc1 |
| InChI | InChI=1S/C17H22FNO3/c1-22-14-8-6-12(7-9-14)15-10-19(13-4-2-3-5-13)11-17(15,18)16(20)21/h6-9,13,15H,2-5,10-11H2,1H3,(H,20,21)/t15?,17-/m0/s1 |
| InChIKey | LSJRMFWDFVHXNX-LWKPJOBUSA-N |
| XLogP | 2.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |