C22H39NO3 — CID 144968395
anisole;1-cyclohexylpyrrolidine-3-carboxylic acid;ethane (PubChem CID 144968395) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is anisole;1-cyclohexylpyrrolidine-3-carboxylic acid;ethane.
| Compound Name | anisole;1-cyclohexylpyrrolidine-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 144968395 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | anisole;1-cyclohexylpyrrolidine-3-carboxylic acid;ethane |
| SMILES | CC.CC.COc1ccccc1.O=C(O)C1CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C11H19NO2.C7H8O.2C2H6/c13-11(14)9-6-7-12(8-9)10-4-2-1-3-5-10;1-8-7-5-3-2-4-6-7;2*1-2/h9-10H,1-8H2,(H,13,14);2-6H,1H3;2*1-2H3 |
| InChIKey | MLSUIYZVKDXODL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |