C20H27N3O2 — CID 96528500
(3R)-N-[(S)-cyano-(2-methoxyphenyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide (PubChem CID 96528500) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (3R)-N-[(S)-cyano-(2-methoxyphenyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(S)-cyano-(2-methoxyphenyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 96528500 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3R)-N-[(S)-cyano-(2-methoxyphenyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1[C@@H](C#N)NC(=O)[C@@H]1CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C20H27N3O2/c1-25-19-10-6-5-9-17(19)18(13-21)22-20(24)15-11-12-23(14-15)16-7-3-2-4-8-16/h5-6,9-10,15-16,18H,2-4,7-8,11-12,14H2,1H3,(H,22,24)/t15-,18-/m1/s1 |
| InChIKey | GSLGYJKBABWUFG-CRAIPNDOSA-N |
| XLogP | 3.03 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |