C17H20N2O3 — CID 95594162
(1S)-N-[(R)-cyano-(2,3-dimethoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 95594162) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (1S)-N-[(R)-cyano-(2,3-dimethoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[(R)-cyano-(2,3-dimethoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95594162 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (1S)-N-[(R)-cyano-(2,3-dimethoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | COc1cccc([C@H](C#N)NC(=O)[C@@H]2CC=CCC2)c1OC |
| InChI | InChI=1S/C17H20N2O3/c1-21-15-10-6-9-13(16(15)22-2)14(11-18)19-17(20)12-7-4-3-5-8-12/h3-4,6,9-10,12,14H,5,7-8H2,1-2H3,(H,19,20)/t12-,14+/m1/s1 |
| InChIKey | RDMYCUMEWMVJPA-OCCSQVGLSA-N |
| XLogP | 2.74 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|