C19H31N3O — CID 127415284
N-[cyano(cyclohexyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide (PubChem CID 127415284) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is N-[cyano(cyclohexyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide.
| Compound Name | N-[cyano(cyclohexyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 127415284 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | N-[cyano(cyclohexyl)methyl]-1-cyclohexylpyrrolidine-3-carboxamide |
| SMILES | N#CC(NC(=O)C1CCN(C2CCCCC2)C1)C1CCCCC1 |
| InChI | InChI=1S/C19H31N3O/c20-13-18(15-7-3-1-4-8-15)21-19(23)16-11-12-22(14-16)17-9-5-2-6-10-17/h15-18H,1-12,14H2,(H,21,23) |
| InChIKey | MHAOGUJMSMPEPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |