C19H37NS — CID 155022367
(2R)-2-ethyl-2,4-dimethyl-6-methylidene-N-[2-(2-methylsulfanylcyclopropyl)ethyl]octan-1-amine (PubChem CID 155022367) has the molecular formula C19H37NS and a molecular weight of 311.58 g/mol. Its IUPAC name is (2R)-2-ethyl-2,4-dimethyl-6-methylidene-N-[2-(2-methylsulfanylcyclopropyl)ethyl]octan-1-amine.
| Compound Name | (2R)-2-ethyl-2,4-dimethyl-6-methylidene-N-[2-(2-methylsulfanylcyclopropyl)ethyl]octan-1-amine |
|---|---|
| PubChem CID | 155022367 |
| Molecular Formula | C19H37NS |
| Molecular Weight | 311.58 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (2R)-2-ethyl-2,4-dimethyl-6-methylidene-N-[2-(2-methylsulfanylcyclopropyl)ethyl]octan-1-amine |
| SMILES | C=C(CC)CC(C)C[C@@](C)(CC)CNCCC1CC1SC |
| InChI | InChI=1S/C19H37NS/c1-7-15(3)11-16(4)13-19(5,8-2)14-20-10-9-17-12-18(17)21-6/h16-18,20H,3,7-14H2,1-2,4-6H3/t16?,17?,18?,19-/m1/s1 |
| InChIKey | NUQUXERQVDITJE-GLCUGAKSSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|