C19H39NS — CID 123309984
4-ethenyl-2-ethyl-N,8-dimethyl-9-methylsulfanyldodecan-1-amine (PubChem CID 123309984) has the molecular formula C19H39NS and a molecular weight of 313.60 g/mol. Its IUPAC name is 4-ethenyl-2-ethyl-N,8-dimethyl-9-methylsulfanyldodecan-1-amine.
| Compound Name | 4-ethenyl-2-ethyl-N,8-dimethyl-9-methylsulfanyldodecan-1-amine |
|---|---|
| PubChem CID | 123309984 |
| Molecular Formula | C19H39NS |
| Molecular Weight | 313.60 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 4-ethenyl-2-ethyl-N,8-dimethyl-9-methylsulfanyldodecan-1-amine |
| SMILES | C=CC(CCCC(C)C(CCC)SC)CC(CC)CNC |
| InChI | InChI=1S/C19H39NS/c1-7-11-19(21-6)16(4)12-10-13-17(8-2)14-18(9-3)15-20-5/h8,16-20H,2,7,9-15H2,1,3-6H3 |
| InChIKey | JFWHWDIKDKNPDV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|