C23H45NS — CID 123679987
N-tert-butyl-6-ethyl-4-[[[(2Z)-hexa-2,5-dien-2-yl]-methyl-λ4-sulfanylidene]methyl]nonan-1-amine (PubChem CID 123679987) has the molecular formula C23H45NS and a molecular weight of 367.69 g/mol. Its IUPAC name is N-tert-butyl-6-ethyl-4-[[[(2Z)-hexa-2,5-dien-2-yl]-methyl-λ4-sulfanylidene]methyl]nonan-1-amine.
| Compound Name | N-tert-butyl-6-ethyl-4-[[[(2Z)-hexa-2,5-dien-2-yl]-methyl-λ4-sulfanylidene]methyl]nonan-1-amine |
|---|---|
| PubChem CID | 123679987 |
| Molecular Formula | C23H45NS |
| Molecular Weight | 367.69 g/mol |
| Exact Mass | 367.33 |
| IUPAC Name | N-tert-butyl-6-ethyl-4-[[[(2Z)-hexa-2,5-dien-2-yl]-methyl-λ4-sulfanylidene]methyl]nonan-1-amine |
| SMILES | C=CC/C=C(/C)S(C)=CC(CCCNC(C)(C)C)CC(CC)CCC |
| InChI | InChI=1S/C23H45NS/c1-9-12-15-20(4)25(8)19-22(18-21(11-3)14-10-2)16-13-17-24-23(5,6)7/h9,15,19,21-22,24H,1,10-14,16-18H2,2-8H3/b20-15- |
| InChIKey | MRDUDVPZQDDONB-HKWRFOASSA-N |
| XLogP | 7.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|