C22H43NS — CID 163457946
(Z,6R)-N-(2,5-dimethylhex-5-enyl)-8-methylsulfanyl-6-propyldec-8-en-2-amine (PubChem CID 163457946) has the molecular formula C22H43NS and a molecular weight of 353.66 g/mol. Its IUPAC name is (Z,6R)-N-(2,5-dimethylhex-5-enyl)-8-methylsulfanyl-6-propyldec-8-en-2-amine.
| Compound Name | (Z,6R)-N-(2,5-dimethylhex-5-enyl)-8-methylsulfanyl-6-propyldec-8-en-2-amine |
|---|---|
| PubChem CID | 163457946 |
| Molecular Formula | C22H43NS |
| Molecular Weight | 353.66 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | (Z,6R)-N-(2,5-dimethylhex-5-enyl)-8-methylsulfanyl-6-propyldec-8-en-2-amine |
| SMILES | C=C(C)CCC(C)CNC(C)CCCC(CCC)C/C(=C/C)SC |
| InChI | InChI=1S/C22H43NS/c1-8-11-21(16-22(9-2)24-7)13-10-12-20(6)23-17-19(5)15-14-18(3)4/h9,19-21,23H,3,8,10-17H2,1-2,4-7H3/b22-9- |
| InChIKey | BMBNPBVKKPRNGY-AFPJDJCSSA-N |
| XLogP | 7.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|