C23H24N4O3S — CID 155022803
(2E,4Z)-2-methyl-N-[4-[3-(morpholine-4-carbonyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]hexa-2,4-dienamide (PubChem CID 155022803) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is (2E,4Z)-2-methyl-N-[4-[3-(morpholine-4-carbonyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-2-methyl-N-[4-[3-(morpholine-4-carbonyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 155022803 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (2E,4Z)-2-methyl-N-[4-[3-(morpholine-4-carbonyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C\C=C(/C)C(=O)Nc1ccc(-c2cn3c(C(=O)N4CCOCC4)csc3n2)cc1 |
| InChI | InChI=1S/C23H24N4O3S/c1-3-4-5-16(2)21(28)24-18-8-6-17(7-9-18)19-14-27-20(15-31-23(27)25-19)22(29)26-10-12-30-13-11-26/h3-9,14-15H,10-13H2,1-2H3,(H,24,28)/b4-3-,16-5+ |
| InChIKey | DQNNNNYWVLXEFM-DCCOREFNSA-N |
| XLogP | 4.00 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|