C53H32N6 — CID 155023204
2-phenyl-9-[4-[6-[2-(1H-pyrrolo[3,2-h]quinolin-3-yl)quinolin-7-yl]quinolin-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 155023204) has the molecular formula C53H32N6 and a molecular weight of 752.88 g/mol. Its IUPAC name is 2-phenyl-9-[4-[6-[2-(1H-pyrrolo[3,2-h]quinolin-3-yl)quinolin-7-yl]quinolin-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-phenyl-9-[4-[6-[2-(1H-pyrrolo[3,2-h]quinolin-3-yl)quinolin-7-yl]quinolin-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 155023204 |
| Molecular Formula | C53H32N6 |
| Molecular Weight | 752.88 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 2-phenyl-9-[4-[6-[2-(1H-pyrrolo[3,2-h]quinolin-3-yl)quinolin-7-yl]quinolin-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2ccc3ccc4ccc(-c5ccc(-c6ccc7cc(-c8ccc9ccc(-c%10c[nH]c%11c%10ccc%10cccnc%10%11)nc9c8)ccc7n6)cc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C53H32N6/c1-2-5-32(6-3-1)45-23-18-37-13-14-38-19-24-46(59-52(38)51(37)58-45)34-10-8-33(9-11-34)44-26-21-41-29-39(20-25-47(41)56-44)40-15-12-35-17-27-48(57-49(35)30-40)43-31-55-53-42(43)22-16-36-7-4-28-54-50(36)53/h1-31,55H |
| InChIKey | ZTSHJOPIQORBQQ-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.88 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|