C25H32N4O4 — CID 155024934
[4-[3-(4-benzylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]methyl carbamate (PubChem CID 155024934) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is [4-[3-(4-benzylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]methyl carbamate.
| Compound Name | [4-[3-(4-benzylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 155024934 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | [4-[3-(4-benzylpiperazin-1-yl)-3-oxo-2-(propanoylamino)propyl]phenyl]methyl carbamate |
| SMILES | CCC(=O)NC(Cc1ccc(COC(N)=O)cc1)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O4/c1-2-23(30)27-22(16-19-8-10-21(11-9-19)18-33-25(26)32)24(31)29-14-12-28(13-15-29)17-20-6-4-3-5-7-20/h3-11,22H,2,12-18H2,1H3,(H2,26,32)(H,27,30) |
| InChIKey | SAWJJLFHJLREIA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |