C29H39N3O — CID 15502574
2-[[bis(2-pyridin-2-ylethyl)amino]methyl]-4,6-ditert-butylphenol (PubChem CID 15502574) has the molecular formula C29H39N3O and a molecular weight of 445.65 g/mol. Its IUPAC name is 2-[[bis(2-pyridin-2-ylethyl)amino]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[bis(2-pyridin-2-ylethyl)amino]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 15502574 |
| Molecular Formula | C29H39N3O |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | 2-[[bis(2-pyridin-2-ylethyl)amino]methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CN(CCc2ccccn2)CCc2ccccn2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H39N3O/c1-28(2,3)23-19-22(27(33)26(20-23)29(4,5)6)21-32(17-13-24-11-7-9-15-30-24)18-14-25-12-8-10-16-31-25/h7-12,15-16,19-20,33H,13-14,17-18,21H2,1-6H3 |
| InChIKey | DRQZELNSKACTFH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|