C27H27NO — CID 155028515
(1R,4R)-4-[(4-methoxyphenyl)methyl]-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,12,14,16-hexaene (PubChem CID 155028515) has the molecular formula C27H27NO and a molecular weight of 381.52 g/mol. Its IUPAC name is (1R,4R)-4-[(4-methoxyphenyl)methyl]-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,12,14,16-hexaene.
| Compound Name | (1R,4R)-4-[(4-methoxyphenyl)methyl]-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,12,14,16-hexaene |
|---|---|
| PubChem CID | 155028515 |
| Molecular Formula | C27H27NO |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (1R,4R)-4-[(4-methoxyphenyl)methyl]-1,11-dimethyl-18-azapentacyclo[9.6.1.02,4.05,10.012,17]octadeca-5,7,9,12,14,16-hexaene |
| SMILES | COc1ccc(C[C@]23CC2[C@@]2(C)NC(C)(c4ccccc43)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H27NO/c1-25-20-8-4-5-9-21(20)26(2,28-25)24-17-27(24,23-11-7-6-10-22(23)25)16-18-12-14-19(29-3)15-13-18/h4-15,24,28H,16-17H2,1-3H3/t24?,25?,26-,27+/m0/s1 |
| InChIKey | AVILPFNRCKMWGG-VPMXTDFASA-N |
| XLogP | 5.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |