C38H63NO — CID 155028791
5-[[(5aR)-5a,5b,8,11a-tetramethyl-9-(4-methylcyclohexen-1-yl)-2,3,4,5,6,7,7a,8,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]amino]-2-methylpentan-2-ol (PubChem CID 155028791) has the molecular formula C38H63NO and a molecular weight of 549.93 g/mol. Its IUPAC name is 5-[[(5aR)-5a,5b,8,11a-tetramethyl-9-(4-methylcyclohexen-1-yl)-2,3,4,5,6,7,7a,8,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]amino]-2-methylpentan-2-ol.
| Compound Name | 5-[[(5aR)-5a,5b,8,11a-tetramethyl-9-(4-methylcyclohexen-1-yl)-2,3,4,5,6,7,7a,8,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 155028791 |
| Molecular Formula | C38H63NO |
| Molecular Weight | 549.93 g/mol |
| Exact Mass | 549.49 |
| IUPAC Name | 5-[[(5aR)-5a,5b,8,11a-tetramethyl-9-(4-methylcyclohexen-1-yl)-2,3,4,5,6,7,7a,8,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]amino]-2-methylpentan-2-ol |
| SMILES | CC1CC=C(C2=CCC3(C)C(CCC4(C)C3CCC3C5CCCC5(NCCCC(C)(C)O)CC[C@]34C)C2C)CC1 |
| InChI | InChI=1S/C38H63NO/c1-26-11-13-28(14-12-26)29-17-21-35(5)30(27(29)2)18-22-37(7)33(35)16-15-31-32-10-8-20-38(32,24-23-36(31,37)6)39-25-9-19-34(3,4)40/h13,17,26-27,30-33,39-40H,8-12,14-16,18-25H2,1-7H3/t26?,27?,30?,31?,32?,33?,35?,36-,37?,38?/m1/s1 |
| InChIKey | HKDOCHLZWJXMOG-WFJALRAASA-N |
| XLogP | 9.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.93 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|