About oxetan-3-yl 2,7-dimethyloctanoate
oxetan-3-yl 2,7-dimethyloctanoate (PubChem CID 155029124) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is oxetan-3-yl 2,7-dimethyloctanoate.
Molecular Properties
| Compound Name | oxetan-3-yl 2,7-dimethyloctanoate |
| PubChem CID | 155029124 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | oxetan-3-yl 2,7-dimethyloctanoate |
| SMILES | CC(C)CCCCC(C)C(=O)OC1COC1 |
| InChI | InChI=1S/C13H24O3/c1-10(2)6-4-5-7-11(3)13(14)16-12-8-15-9-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | NDYUJRFFINTLEE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze oxetan-3-yl 2,7-dimethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-3-yl 2,7-dimethyloctanoate?
The IUPAC name of oxetan-3-yl 2,7-dimethyloctanoate (CID 155029124) is oxetan-3-yl 2,7-dimethyloctanoate.
What is the SMILES notation for oxetan-3-yl 2,7-dimethyloctanoate?
The canonical SMILES for oxetan-3-yl 2,7-dimethyloctanoate is CC(C)CCCCC(C)C(=O)OC1COC1.
What is the InChIKey of oxetan-3-yl 2,7-dimethyloctanoate?
The InChIKey is NDYUJRFFINTLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-10(2)6-4-5-7-11(3)13(14)16-12-8-15-9-12/h10-12H,4-9H2,1-3H3.
What are the key properties of oxetan-3-yl 2,7-dimethyloctanoate?
oxetan-3-yl 2,7-dimethyloctanoate has a molecular weight of 228.33 g/mol, XLogP of 2.78, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-yl 2,7-dimethyloctanoate is sourced from PubChem (CID 155029124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).