C20H29NO3 — CID 155031168
4-(3-methoxycyclobutyl)oxy-1-[5-(3-methoxyprop-1-ynyl)cyclohexa-1,3-dien-1-yl]piperidine (PubChem CID 155031168) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-(3-methoxycyclobutyl)oxy-1-[5-(3-methoxyprop-1-ynyl)cyclohexa-1,3-dien-1-yl]piperidine.
| Compound Name | 4-(3-methoxycyclobutyl)oxy-1-[5-(3-methoxyprop-1-ynyl)cyclohexa-1,3-dien-1-yl]piperidine |
|---|---|
| PubChem CID | 155031168 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 4-(3-methoxycyclobutyl)oxy-1-[5-(3-methoxyprop-1-ynyl)cyclohexa-1,3-dien-1-yl]piperidine |
| SMILES | COCC#CC1C=CC=C(N2CCC(OC3CC(OC)C3)CC2)C1 |
| InChI | InChI=1S/C20H29NO3/c1-22-12-4-6-16-5-3-7-17(13-16)21-10-8-18(9-11-21)24-20-14-19(15-20)23-2/h3,5,7,16,18-20H,8-15H2,1-2H3 |
| InChIKey | MTBIRLAPFZWIQS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|